C29H27FNO+ — CID 153464364
5-cyclopentyl-2-(7-fluoro-2,3-dimethyldibenzofuran-4-yl)-1-methylquinolin-1-ium (PubChem CID 153464364) has the molecular formula C29H27FNO+ and a molecular weight of 424.54 g/mol. Its IUPAC name is 5-cyclopentyl-2-(7-fluoro-2,3-dimethyldibenzofuran-4-yl)-1-methylquinolin-1-ium.
| Compound Name | 5-cyclopentyl-2-(7-fluoro-2,3-dimethyldibenzofuran-4-yl)-1-methylquinolin-1-ium |
|---|---|
| PubChem CID | 153464364 |
| Molecular Formula | C29H27FNO+ |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | 5-cyclopentyl-2-(7-fluoro-2,3-dimethyldibenzofuran-4-yl)-1-methylquinolin-1-ium |
| SMILES | Cc1cc2c(oc3cc(F)ccc32)c(-c2ccc3c(C4CCCC4)cccc3[n+]2C)c1C |
| InChI | InChI=1S/C29H27FNO/c1-17-15-24-23-12-11-20(30)16-27(23)32-29(24)28(18(17)2)26-14-13-22-21(19-7-4-5-8-19)9-6-10-25(22)31(26)3/h6,9-16,19H,4-5,7-8H2,1-3H3/q+1 |
| InChIKey | QDZQEXUQCDIPID-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|