C29H29F2N2O+ — CID 153464370
2-(7,9-difluoro-3-methyldibenzofuran-4-yl)-1-[2,6-di(propan-2-yl)phenyl]-3-methylimidazol-3-ium (PubChem CID 153464370) has the molecular formula C29H29F2N2O+ and a molecular weight of 459.56 g/mol. Its IUPAC name is 2-(7,9-difluoro-3-methyldibenzofuran-4-yl)-1-[2,6-di(propan-2-yl)phenyl]-3-methylimidazol-3-ium.
| Compound Name | 2-(7,9-difluoro-3-methyldibenzofuran-4-yl)-1-[2,6-di(propan-2-yl)phenyl]-3-methylimidazol-3-ium |
|---|---|
| PubChem CID | 153464370 |
| Molecular Formula | C29H29F2N2O+ |
| Molecular Weight | 459.56 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | 2-(7,9-difluoro-3-methyldibenzofuran-4-yl)-1-[2,6-di(propan-2-yl)phenyl]-3-methylimidazol-3-ium |
| SMILES | Cc1ccc2c(oc3cc(F)cc(F)c32)c1-c1n(-c2c(C(C)C)cccc2C(C)C)cc[n+]1C |
| InChI | InChI=1S/C29H29F2N2O/c1-16(2)20-8-7-9-21(17(3)4)27(20)33-13-12-32(6)29(33)25-18(5)10-11-22-26-23(31)14-19(30)15-24(26)34-28(22)25/h7-17H,1-6H3/q+1 |
| InChIKey | JJFNSSGZKBXMKA-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 21.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.56 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|