C38H26F2N3O+ — CID 153464379
8-[1-(2,6-diphenylphenyl)-3-methylbenzimidazol-3-ium-2-yl]-2,4-difluoro-7-methyl-[1]benzofuro[2,3-b]pyridine (PubChem CID 153464379) has the molecular formula C38H26F2N3O+ and a molecular weight of 578.64 g/mol. Its IUPAC name is 8-[1-(2,6-diphenylphenyl)-3-methylbenzimidazol-3-ium-2-yl]-2,4-difluoro-7-methyl-[1]benzofuro[2,3-b]pyridine.
| Compound Name | 8-[1-(2,6-diphenylphenyl)-3-methylbenzimidazol-3-ium-2-yl]-2,4-difluoro-7-methyl-[1]benzofuro[2,3-b]pyridine |
|---|---|
| PubChem CID | 153464379 |
| Molecular Formula | C38H26F2N3O+ |
| Molecular Weight | 578.64 g/mol |
| Exact Mass | 578.20 |
| IUPAC Name | 8-[1-(2,6-diphenylphenyl)-3-methylbenzimidazol-3-ium-2-yl]-2,4-difluoro-7-methyl-[1]benzofuro[2,3-b]pyridine |
| SMILES | Cc1ccc2c(oc3nc(F)cc(F)c32)c1-c1n(-c2c(-c3ccccc3)cccc2-c2ccccc2)c2ccccc2[n+]1C |
| InChI | InChI=1S/C38H26F2N3O/c1-23-20-21-28-34-29(39)22-32(40)41-37(34)44-36(28)33(23)38-42(2)30-18-9-10-19-31(30)43(38)35-26(24-12-5-3-6-13-24)16-11-17-27(35)25-14-7-4-8-15-25/h3-22H,1-2H3/q+1 |
| InChIKey | JVZDVUBDIQSSNK-UHFFFAOYSA-N |
| XLogP | 9.34 |
| TPSA | 34.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.64 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|