C34H25FN3O+ — CID 153464391
6-[1-(2,6-diphenylphenyl)-3-methylimidazol-3-ium-2-yl]-2-fluoro-7-methyl-[1]benzofuro[2,3-b]pyridine (PubChem CID 153464391) has the molecular formula C34H25FN3O+ and a molecular weight of 510.59 g/mol. Its IUPAC name is 6-[1-(2,6-diphenylphenyl)-3-methylimidazol-3-ium-2-yl]-2-fluoro-7-methyl-[1]benzofuro[2,3-b]pyridine.
| Compound Name | 6-[1-(2,6-diphenylphenyl)-3-methylimidazol-3-ium-2-yl]-2-fluoro-7-methyl-[1]benzofuro[2,3-b]pyridine |
|---|---|
| PubChem CID | 153464391 |
| Molecular Formula | C34H25FN3O+ |
| Molecular Weight | 510.59 g/mol |
| Exact Mass | 510.20 |
| IUPAC Name | 6-[1-(2,6-diphenylphenyl)-3-methylimidazol-3-ium-2-yl]-2-fluoro-7-methyl-[1]benzofuro[2,3-b]pyridine |
| SMILES | Cc1cc2oc3nc(F)ccc3c2cc1-c1n(-c2c(-c3ccccc3)cccc2-c2ccccc2)cc[n+]1C |
| InChI | InChI=1S/C34H25FN3O/c1-22-20-30-29(27-16-17-31(35)36-33(27)39-30)21-28(22)34-37(2)18-19-38(34)32-25(23-10-5-3-6-11-23)14-9-15-26(32)24-12-7-4-8-13-24/h3-21H,1-2H3/q+1 |
| InChIKey | YMZXFLVYYCXRJI-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 34.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.59 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|