C27H19F2N2O+ — CID 153464466
2-(7,9-difluoro-3-methyldibenzofuran-2-yl)-1-methyl-3-phenylbenzimidazol-1-ium (PubChem CID 153464466) has the molecular formula C27H19F2N2O+ and a molecular weight of 425.46 g/mol. Its IUPAC name is 2-(7,9-difluoro-3-methyldibenzofuran-2-yl)-1-methyl-3-phenylbenzimidazol-1-ium.
| Compound Name | 2-(7,9-difluoro-3-methyldibenzofuran-2-yl)-1-methyl-3-phenylbenzimidazol-1-ium |
|---|---|
| PubChem CID | 153464466 |
| Molecular Formula | C27H19F2N2O+ |
| Molecular Weight | 425.46 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | 2-(7,9-difluoro-3-methyldibenzofuran-2-yl)-1-methyl-3-phenylbenzimidazol-1-ium |
| SMILES | Cc1cc2oc3cc(F)cc(F)c3c2cc1-c1n(-c2ccccc2)c2ccccc2[n+]1C |
| InChI | InChI=1S/C27H19F2N2O/c1-16-12-24-20(26-21(29)13-17(28)14-25(26)32-24)15-19(16)27-30(2)22-10-6-7-11-23(22)31(27)18-8-4-3-5-9-18/h3-15H,1-2H3/q+1 |
| InChIKey | GFXDKRYEYCXHJH-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 21.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.46 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|