C35H26FN2O+ — CID 153464475
1-(2,6-diphenylphenyl)-2-(7-fluoro-2-methyldibenzofuran-3-yl)-3-methylimidazol-3-ium (PubChem CID 153464475) has the molecular formula C35H26FN2O+ and a molecular weight of 509.60 g/mol. Its IUPAC name is 1-(2,6-diphenylphenyl)-2-(7-fluoro-2-methyldibenzofuran-3-yl)-3-methylimidazol-3-ium.
| Compound Name | 1-(2,6-diphenylphenyl)-2-(7-fluoro-2-methyldibenzofuran-3-yl)-3-methylimidazol-3-ium |
|---|---|
| PubChem CID | 153464475 |
| Molecular Formula | C35H26FN2O+ |
| Molecular Weight | 509.60 g/mol |
| Exact Mass | 509.20 |
| IUPAC Name | 1-(2,6-diphenylphenyl)-2-(7-fluoro-2-methyldibenzofuran-3-yl)-3-methylimidazol-3-ium |
| SMILES | Cc1cc2c(cc1-c1n(-c3c(-c4ccccc4)cccc3-c3ccccc3)cc[n+]1C)oc1cc(F)ccc12 |
| InChI | InChI=1S/C35H26FN2O/c1-23-20-31-29-17-16-26(36)21-32(29)39-33(31)22-30(23)35-37(2)18-19-38(35)34-27(24-10-5-3-6-11-24)14-9-15-28(34)25-12-7-4-8-13-25/h3-22H,1-2H3/q+1 |
| InChIKey | FSIDTMPUJNZGMA-UHFFFAOYSA-N |
| XLogP | 8.65 |
| TPSA | 21.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.60 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|