C22H16F2N3O+ — CID 153464540
2,5-difluoro-7-methyl-8-(1-methyl-3-phenylimidazol-1-ium-2-yl)-[1]benzofuro[2,3-b]pyridine (PubChem CID 153464540) has the molecular formula C22H16F2N3O+ and a molecular weight of 376.39 g/mol. Its IUPAC name is 2,5-difluoro-7-methyl-8-(1-methyl-3-phenylimidazol-1-ium-2-yl)-[1]benzofuro[2,3-b]pyridine.
| Compound Name | 2,5-difluoro-7-methyl-8-(1-methyl-3-phenylimidazol-1-ium-2-yl)-[1]benzofuro[2,3-b]pyridine |
|---|---|
| PubChem CID | 153464540 |
| Molecular Formula | C22H16F2N3O+ |
| Molecular Weight | 376.39 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | 2,5-difluoro-7-methyl-8-(1-methyl-3-phenylimidazol-1-ium-2-yl)-[1]benzofuro[2,3-b]pyridine |
| SMILES | Cc1cc(F)c2c(oc3nc(F)ccc32)c1-c1n(-c2ccccc2)cc[n+]1C |
| InChI | InChI=1S/C22H16F2N3O/c1-13-12-16(23)19-15-8-9-17(24)25-21(15)28-20(19)18(13)22-26(2)10-11-27(22)14-6-4-3-5-7-14/h3-12H,1-2H3/q+1 |
| InChIKey | WKILOOZLOXTJJC-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 34.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.39 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|