C23H25ClFNS — CID 15346458
4-(4-tert-butylphenyl)-2-(2-chloro-6-fluorophenyl)-4,4a,5,6,7,7a-hexahydrocyclopenta[e][1,3]thiazine (PubChem CID 15346458) has the molecular formula C23H25ClFNS and a molecular weight of 401.98 g/mol. Its IUPAC name is 4-(4-tert-butylphenyl)-2-(2-chloro-6-fluorophenyl)-4,4a,5,6,7,7a-hexahydrocyclopenta[e][1,3]thiazine.
| Compound Name | 4-(4-tert-butylphenyl)-2-(2-chloro-6-fluorophenyl)-4,4a,5,6,7,7a-hexahydrocyclopenta[e][1,3]thiazine |
|---|---|
| PubChem CID | 15346458 |
| Molecular Formula | C23H25ClFNS |
| Molecular Weight | 401.98 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 4-(4-tert-butylphenyl)-2-(2-chloro-6-fluorophenyl)-4,4a,5,6,7,7a-hexahydrocyclopenta[e][1,3]thiazine |
| SMILES | CC(C)(C)c1ccc(C2N=C(c3c(F)cccc3Cl)SC3CCCC32)cc1 |
| InChI | InChI=1S/C23H25ClFNS/c1-23(2,3)15-12-10-14(11-13-15)21-16-6-4-9-19(16)27-22(26-21)20-17(24)7-5-8-18(20)25/h5,7-8,10-13,16,19,21H,4,6,9H2,1-3H3 |
| InChIKey | DLIGNKLKWVSUKN-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.98 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |