C24H17FN3OS+ — CID 153464657
2-fluoro-6,7-dimethyl-8-(3-methyl-[1]benzothiolo[3,2-d]pyrimidin-3-ium-4-yl)-[1]benzofuro[2,3-b]pyridine (PubChem CID 153464657) has the molecular formula C24H17FN3OS+ and a molecular weight of 414.49 g/mol. Its IUPAC name is 2-fluoro-6,7-dimethyl-8-(3-methyl-[1]benzothiolo[3,2-d]pyrimidin-3-ium-4-yl)-[1]benzofuro[2,3-b]pyridine.
| Compound Name | 2-fluoro-6,7-dimethyl-8-(3-methyl-[1]benzothiolo[3,2-d]pyrimidin-3-ium-4-yl)-[1]benzofuro[2,3-b]pyridine |
|---|---|
| PubChem CID | 153464657 |
| Molecular Formula | C24H17FN3OS+ |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | 2-fluoro-6,7-dimethyl-8-(3-methyl-[1]benzothiolo[3,2-d]pyrimidin-3-ium-4-yl)-[1]benzofuro[2,3-b]pyridine |
| SMILES | Cc1cc2c(oc3nc(F)ccc32)c(-c2c3sc4ccccc4c3nc[n+]2C)c1C |
| InChI | InChI=1S/C24H17FN3OS/c1-12-10-16-14-8-9-18(25)27-24(14)29-22(16)19(13(12)2)21-23-20(26-11-28(21)3)15-6-4-5-7-17(15)30-23/h4-11H,1-3H3/q+1 |
| InChIKey | PVRYSLITNWQXMS-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 42.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|