C34H24F2N3O+ — CID 153464826
8-[1-(2,6-diphenylphenyl)-3-methylimidazol-3-ium-2-yl]-2,4-difluoro-7-methyl-[1]benzofuro[2,3-b]pyridine (PubChem CID 153464826) has the molecular formula C34H24F2N3O+ and a molecular weight of 528.58 g/mol. Its IUPAC name is 8-[1-(2,6-diphenylphenyl)-3-methylimidazol-3-ium-2-yl]-2,4-difluoro-7-methyl-[1]benzofuro[2,3-b]pyridine.
| Compound Name | 8-[1-(2,6-diphenylphenyl)-3-methylimidazol-3-ium-2-yl]-2,4-difluoro-7-methyl-[1]benzofuro[2,3-b]pyridine |
|---|---|
| PubChem CID | 153464826 |
| Molecular Formula | C34H24F2N3O+ |
| Molecular Weight | 528.58 g/mol |
| Exact Mass | 528.19 |
| IUPAC Name | 8-[1-(2,6-diphenylphenyl)-3-methylimidazol-3-ium-2-yl]-2,4-difluoro-7-methyl-[1]benzofuro[2,3-b]pyridine |
| SMILES | Cc1ccc2c(oc3nc(F)cc(F)c32)c1-c1n(-c2c(-c3ccccc3)cccc2-c2ccccc2)cc[n+]1C |
| InChI | InChI=1S/C34H24F2N3O/c1-21-16-17-26-30-27(35)20-28(36)37-33(30)40-32(26)29(21)34-38(2)18-19-39(34)31-24(22-10-5-3-6-11-22)14-9-15-25(31)23-12-7-4-8-13-23/h3-20H,1-2H3/q+1 |
| InChIKey | BIJSLZVUGBAXHW-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 34.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.58 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|