C29H21F2N2O+ — CID 153464833
2-(1,7-difluoro-3-methyldibenzofuran-4-yl)-1-methyl-3-(2-phenylphenyl)imidazol-1-ium (PubChem CID 153464833) has the molecular formula C29H21F2N2O+ and a molecular weight of 451.50 g/mol. Its IUPAC name is 2-(1,7-difluoro-3-methyldibenzofuran-4-yl)-1-methyl-3-(2-phenylphenyl)imidazol-1-ium.
| Compound Name | 2-(1,7-difluoro-3-methyldibenzofuran-4-yl)-1-methyl-3-(2-phenylphenyl)imidazol-1-ium |
|---|---|
| PubChem CID | 153464833 |
| Molecular Formula | C29H21F2N2O+ |
| Molecular Weight | 451.50 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | 2-(1,7-difluoro-3-methyldibenzofuran-4-yl)-1-methyl-3-(2-phenylphenyl)imidazol-1-ium |
| SMILES | Cc1cc(F)c2c(oc3cc(F)ccc32)c1-c1n(-c2ccccc2-c2ccccc2)cc[n+]1C |
| InChI | InChI=1S/C29H21F2N2O/c1-18-16-23(31)27-22-13-12-20(30)17-25(22)34-28(27)26(18)29-32(2)14-15-33(29)24-11-7-6-10-21(24)19-8-4-3-5-9-19/h3-17H,1-2H3/q+1 |
| InChIKey | VMNWXDBGCZAVTB-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 21.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.50 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|