C9H11F6N5 — CID 153465412
2-N,4-N-bis[(2R)-1,1,1-trifluoropropan-2-yl]-1,3,5-triazine-2,4-diamine (PubChem CID 153465412) has the molecular formula C9H11F6N5 and a molecular weight of 303.21 g/mol. Its IUPAC name is 2-N,4-N-bis[(2R)-1,1,1-trifluoropropan-2-yl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,4-N-bis[(2R)-1,1,1-trifluoropropan-2-yl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 153465412 |
| Molecular Formula | C9H11F6N5 |
| Molecular Weight | 303.21 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 2-N,4-N-bis[(2R)-1,1,1-trifluoropropan-2-yl]-1,3,5-triazine-2,4-diamine |
| SMILES | C[C@@H](Nc1ncnc(N[C@H](C)C(F)(F)F)n1)C(F)(F)F |
| InChI | InChI=1S/C9H11F6N5/c1-4(8(10,11)12)18-6-16-3-17-7(20-6)19-5(2)9(13,14)15/h3-5H,1-2H3,(H2,16,17,18,19,20)/t4-,5-/m1/s1 |
| InChIKey | RKFOQSDZSUGZDB-RFZPGFLSSA-N |
| XLogP | 2.60 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.21 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |