C61H35N5 — CID 153466253
2-[3,5-di(fluoranthen-3-yl)phenyl]-4-naphthalen-1-yl-6-(4-pyrimidin-5-ylphenyl)-1,3,5-triazine (PubChem CID 153466253) has the molecular formula C61H35N5 and a molecular weight of 837.99 g/mol. Its IUPAC name is 2-[3,5-di(fluoranthen-3-yl)phenyl]-4-naphthalen-1-yl-6-(4-pyrimidin-5-ylphenyl)-1,3,5-triazine.
| Compound Name | 2-[3,5-di(fluoranthen-3-yl)phenyl]-4-naphthalen-1-yl-6-(4-pyrimidin-5-ylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 153466253 |
| Molecular Formula | C61H35N5 |
| Molecular Weight | 837.99 g/mol |
| Exact Mass | 837.29 |
| IUPAC Name | 2-[3,5-di(fluoranthen-3-yl)phenyl]-4-naphthalen-1-yl-6-(4-pyrimidin-5-ylphenyl)-1,3,5-triazine |
| SMILES | c1ccc2c(c1)-c1cccc3c(-c4cc(-c5nc(-c6ccc(-c7cncnc7)cc6)nc(-c6cccc7ccccc67)n5)cc(-c5ccc6c7c(cccc57)-c5ccccc5-6)c4)ccc-2c13 |
| InChI | InChI=1S/C61H35N5/c1-2-12-43-37(10-1)11-7-21-56(43)61-65-59(38-24-22-36(23-25-38)42-33-62-35-63-34-42)64-60(66-61)41-31-39(44-26-28-54-48-15-5-3-13-46(48)52-19-8-17-50(44)57(52)54)30-40(32-41)45-27-29-55-49-16-6-4-14-47(49)53-20-9-18-51(45)58(53)55/h1-35H |
| InChIKey | AYYNOBAYJGHSTK-UHFFFAOYSA-N |
| XLogP | 15.42 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 837.99 |
| LogP ≤ 5 | 15.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |