C27H37NO4S — CID 153466398
2-ethyl-2-[4-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)sulfonylamino]phenyl]butanoic acid (PubChem CID 153466398) has the molecular formula C27H37NO4S and a molecular weight of 471.66 g/mol. Its IUPAC name is 2-ethyl-2-[4-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)sulfonylamino]phenyl]butanoic acid.
| Compound Name | 2-ethyl-2-[4-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)sulfonylamino]phenyl]butanoic acid |
|---|---|
| PubChem CID | 153466398 |
| Molecular Formula | C27H37NO4S |
| Molecular Weight | 471.66 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | 2-ethyl-2-[4-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)sulfonylamino]phenyl]butanoic acid |
| SMILES | CCC(CC)(C(=O)O)c1ccc(NS(=O)(=O)c2cc3c(cc2C)C(C)(C)CCC3(C)C)cc1 |
| InChI | InChI=1S/C27H37NO4S/c1-8-27(9-2,24(29)30)19-10-12-20(13-11-19)28-33(31,32)23-17-22-21(16-18(23)3)25(4,5)14-15-26(22,6)7/h10-13,16-17,28H,8-9,14-15H2,1-7H3,(H,29,30) |
| InChIKey | NXQREWXHBBIHHU-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.66 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |