About CID 153466574
CID 153466574 (PubChem CID 153466574) has the molecular formula C37H41F3IrNO2-
and a molecular weight of 780.95 g/mol.
Molecular Properties
| Compound Name | CID 153466574 |
| PubChem CID | 153466574 |
| Molecular Formula | C37H41F3IrNO2- |
| Molecular Weight | 780.95 g/mol |
| Exact Mass | 781.27 |
| IUPAC Name | — |
| SMILES | CC(C)(Cc1cc2ccnc3c4[c-]ccc5cccc(c(c1)c23)c54)C(F)(F)F.CCC(CC)C(=O)/C=C(\O)C(CC)CC.[Ir] |
| InChI | InChI=1S/C24H17F3N.C13H24O2.Ir/c1-23(2,24(25,26)27)13-14-11-16-9-10-28-22-18-8-4-6-15-5-3-7-17(20(15)18)19(12-14)21(16)22;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h3-7,9-12H,13H2,1-2H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | RSRMPDAGPQKWJJ-DZTQYQPZSA-N |
| XLogP | 10.93 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 780.95 |
| LogP ≤ 5 | 10.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze CID 153466574 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 153466574?
The IUPAC name of CID 153466574 (CID 153466574) is not available.
What is the SMILES notation for CID 153466574?
The canonical SMILES for CID 153466574 is CC(C)(Cc1cc2ccnc3c4[c-]ccc5cccc(c(c1)c23)c54)C(F)(F)F.CCC(CC)C(=O)/C=C(\O)C(CC)CC.[Ir].
What is the InChIKey of CID 153466574?
The InChIKey is RSRMPDAGPQKWJJ-DZTQYQPZSA-N. The full InChI is InChI=1S/C24H17F3N.C13H24O2.Ir/c1-23(2,24(25,26)27)13-14-11-16-9-10-28-22-18-8-4-6-15-5-3-7-17(20(15)18)19(12-14)21(16)22;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h3-7,9-12H,13H2,1-2H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-;.
What are the key properties of CID 153466574?
CID 153466574 has a molecular weight of 780.95 g/mol, XLogP of 10.93, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 153466574 is sourced from PubChem (CID 153466574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).