C24H22N2 — CID 153466596
8-(2,2-dimethylpropyl)-17-methyl-3,4-diazapentacyclo[9.7.1.12,6.015,19.010,20]icosa-1(18),2(20),3,5,7,9,11,13,15(19),16-decaene (PubChem CID 153466596) has the molecular formula C24H22N2 and a molecular weight of 338.45 g/mol. Its IUPAC name is 8-(2,2-dimethylpropyl)-17-methyl-3,4-diazapentacyclo[9.7.1.12,6.015,19.010,20]icosa-1(18),2(20),3,5,7,9,11,13,15(19),16-decaene.
| Compound Name | 8-(2,2-dimethylpropyl)-17-methyl-3,4-diazapentacyclo[9.7.1.12,6.015,19.010,20]icosa-1(18),2(20),3,5,7,9,11,13,15(19),16-decaene |
|---|---|
| PubChem CID | 153466596 |
| Molecular Formula | C24H22N2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | 8-(2,2-dimethylpropyl)-17-methyl-3,4-diazapentacyclo[9.7.1.12,6.015,19.010,20]icosa-1(18),2(20),3,5,7,9,11,13,15(19),16-decaene |
| SMILES | Cc1cc2cccc3c4cc(CC(C)(C)C)cc5cnnc(c(c1)c23)c54 |
| InChI | InChI=1S/C24H22N2/c1-14-8-16-6-5-7-18-19-11-15(12-24(2,3)4)10-17-13-25-26-23(22(17)19)20(9-14)21(16)18/h5-11,13H,12H2,1-4H3 |
| InChIKey | FWMILXWARFMJPO-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|