C14H24O3Si — CID 153467094
[(2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-6-ethynyl-3,6-dihydro-2H-pyran-2-yl]methanol (PubChem CID 153467094) has the molecular formula C14H24O3Si and a molecular weight of 268.43 g/mol. Its IUPAC name is [(2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-6-ethynyl-3,6-dihydro-2H-pyran-2-yl]methanol.
| Compound Name | [(2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-6-ethynyl-3,6-dihydro-2H-pyran-2-yl]methanol |
|---|---|
| PubChem CID | 153467094 |
| Molecular Formula | C14H24O3Si |
| Molecular Weight | 268.43 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | [(2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-6-ethynyl-3,6-dihydro-2H-pyran-2-yl]methanol |
| SMILES | C#CC1C=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O1 |
| InChI | InChI=1S/C14H24O3Si/c1-7-11-8-9-12(13(10-15)16-11)17-18(5,6)14(2,3)4/h1,8-9,11-13,15H,10H2,2-6H3/t11?,12-,13-/m1/s1 |
| InChIKey | ZCGBDISOKBXKCD-VFRRUGBOSA-N |
| XLogP | 2.33 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.43 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|