C17H21ClN2O5 — CID 153467437
(4S)-4-[[5-chloro-3-(2-ethoxy-2-oxoethyl)-2,3-dihydroindol-1-yl]amino]-5-oxopentanoic acid (PubChem CID 153467437) has the molecular formula C17H21ClN2O5 and a molecular weight of 368.82 g/mol. Its IUPAC name is (4S)-4-[[5-chloro-3-(2-ethoxy-2-oxoethyl)-2,3-dihydroindol-1-yl]amino]-5-oxopentanoic acid.
| Compound Name | (4S)-4-[[5-chloro-3-(2-ethoxy-2-oxoethyl)-2,3-dihydroindol-1-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 153467437 |
| Molecular Formula | C17H21ClN2O5 |
| Molecular Weight | 368.82 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | (4S)-4-[[5-chloro-3-(2-ethoxy-2-oxoethyl)-2,3-dihydroindol-1-yl]amino]-5-oxopentanoic acid |
| SMILES | CCOC(=O)CC1CN(N[C@H](C=O)CCC(=O)O)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C17H21ClN2O5/c1-2-25-17(24)7-11-9-20(15-5-3-12(18)8-14(11)15)19-13(10-21)4-6-16(22)23/h3,5,8,10-11,13,19H,2,4,6-7,9H2,1H3,(H,22,23)/t11?,13-/m0/s1 |
| InChIKey | JMNWROZBUKMBLX-YUZLPWPTSA-N |
| XLogP | 2.13 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.82 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|