About sulfanyl-sulfanylidene-sulfanylperoxyperoxy-λ4-sulfane
sulfanyl-sulfanylidene-sulfanylperoxyperoxy-λ4-sulfane (PubChem CID 153467628) has the molecular formula H2O4S4
and a molecular weight of 194.28 g/mol. Its IUPAC name is sulfanyl-sulfanylidene-sulfanylperoxyperoxy-λ4-sulfane.
Molecular Properties
| Compound Name | sulfanyl-sulfanylidene-sulfanylperoxyperoxy-λ4-sulfane |
| PubChem CID | 153467628 |
| Molecular Formula | H2O4S4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 193.88 |
| IUPAC Name | sulfanyl-sulfanylidene-sulfanylperoxyperoxy-λ4-sulfane |
| SMILES | S=S(S)OOOOS |
| InChI | InChI=1S/H2O4S4/c5-3-1-2-4-8(6)7/h5H,(H,6,7) |
| InChIKey | NFUPJEGIKLTDBR-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 36.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze sulfanyl-sulfanylidene-sulfanylperoxyperoxy-λ4-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sulfanyl-sulfanylidene-sulfanylperoxyperoxy-λ4-sulfane?
The IUPAC name of sulfanyl-sulfanylidene-sulfanylperoxyperoxy-λ4-sulfane (CID 153467628) is sulfanyl-sulfanylidene-sulfanylperoxyperoxy-λ4-sulfane.
What is the SMILES notation for sulfanyl-sulfanylidene-sulfanylperoxyperoxy-λ4-sulfane?
The canonical SMILES for sulfanyl-sulfanylidene-sulfanylperoxyperoxy-λ4-sulfane is S=S(S)OOOOS.
What is the InChIKey of sulfanyl-sulfanylidene-sulfanylperoxyperoxy-λ4-sulfane?
The InChIKey is NFUPJEGIKLTDBR-UHFFFAOYSA-N. The full InChI is InChI=1S/H2O4S4/c5-3-1-2-4-8(6)7/h5H,(H,6,7).
What are the key properties of sulfanyl-sulfanylidene-sulfanylperoxyperoxy-λ4-sulfane?
sulfanyl-sulfanylidene-sulfanylperoxyperoxy-λ4-sulfane has a molecular weight of 194.28 g/mol, XLogP of 0.48, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for sulfanyl-sulfanylidene-sulfanylperoxyperoxy-λ4-sulfane is sourced from PubChem (CID 153467628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).