About californium;(2-methyl-1-oxo-1-phenylpropan-2-yl) 2-methylbutanoate
californium;(2-methyl-1-oxo-1-phenylpropan-2-yl) 2-methylbutanoate (PubChem CID 153467655) has the molecular formula C15H19CfO3-
and a molecular weight of 498.31 g/mol. Its IUPAC name is californium;(2-methyl-1-oxo-1-phenylpropan-2-yl) 2-methylbutanoate.
Molecular Properties
| Compound Name | californium;(2-methyl-1-oxo-1-phenylpropan-2-yl) 2-methylbutanoate |
| PubChem CID | 153467655 |
| Molecular Formula | C15H19CfO3- |
| Molecular Weight | 498.31 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | californium;(2-methyl-1-oxo-1-phenylpropan-2-yl) 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OC(C)(C)C(=O)c1cc[c-]cc1.[Cf] |
| InChI | InChI=1S/C15H19O3.Cf/c1-5-11(2)14(17)18-15(3,4)13(16)12-9-7-6-8-10-12;/h7-11H,5H2,1-4H3;/q-1; |
| InChIKey | BUVZJPLOURIMAQ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 498.31 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze californium;(2-methyl-1-oxo-1-phenylpropan-2-yl) 2-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of californium;(2-methyl-1-oxo-1-phenylpropan-2-yl) 2-methylbutanoate?
The IUPAC name of californium;(2-methyl-1-oxo-1-phenylpropan-2-yl) 2-methylbutanoate (CID 153467655) is californium;(2-methyl-1-oxo-1-phenylpropan-2-yl) 2-methylbutanoate.
What is the SMILES notation for californium;(2-methyl-1-oxo-1-phenylpropan-2-yl) 2-methylbutanoate?
The canonical SMILES for californium;(2-methyl-1-oxo-1-phenylpropan-2-yl) 2-methylbutanoate is CCC(C)C(=O)OC(C)(C)C(=O)c1cc[c-]cc1.[Cf].
What is the InChIKey of californium;(2-methyl-1-oxo-1-phenylpropan-2-yl) 2-methylbutanoate?
The InChIKey is BUVZJPLOURIMAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19O3.Cf/c1-5-11(2)14(17)18-15(3,4)13(16)12-9-7-6-8-10-12;/h7-11H,5H2,1-4H3;/q-1;.
What are the key properties of californium;(2-methyl-1-oxo-1-phenylpropan-2-yl) 2-methylbutanoate?
californium;(2-methyl-1-oxo-1-phenylpropan-2-yl) 2-methylbutanoate has a molecular weight of 498.31 g/mol, XLogP of 3.04, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for californium;(2-methyl-1-oxo-1-phenylpropan-2-yl) 2-methylbutanoate is sourced from PubChem (CID 153467655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).