C17H5F4I4O6- — CID 153468002
4-(2-ethoxycarbonyl-3,4,5,6-tetraiodobenzoyl)oxy-2,3,5,6-tetrafluorobenzoate (PubChem CID 153468002) has the molecular formula C17H5F4I4O6- and a molecular weight of 888.83 g/mol. Its IUPAC name is 4-(2-ethoxycarbonyl-3,4,5,6-tetraiodobenzoyl)oxy-2,3,5,6-tetrafluorobenzoate.
| Compound Name | 4-(2-ethoxycarbonyl-3,4,5,6-tetraiodobenzoyl)oxy-2,3,5,6-tetrafluorobenzoate |
|---|---|
| PubChem CID | 153468002 |
| Molecular Formula | C17H5F4I4O6- |
| Molecular Weight | 888.83 g/mol |
| Exact Mass | 888.62 |
| IUPAC Name | 4-(2-ethoxycarbonyl-3,4,5,6-tetraiodobenzoyl)oxy-2,3,5,6-tetrafluorobenzoate |
| SMILES | CCOC(=O)c1c(I)c(I)c(I)c(I)c1C(=O)Oc1c(F)c(F)c(C(=O)[O-])c(F)c1F |
| InChI | InChI=1S/C17H6F4I4O6/c1-2-30-16(28)3-4(11(23)13(25)12(24)10(3)22)17(29)31-14-8(20)6(18)5(15(26)27)7(19)9(14)21/h2H2,1H3,(H,26,27)/p-1 |
| InChIKey | FBSPIRLCNWYLEE-UHFFFAOYSA-M |
| XLogP | 4.42 |
| TPSA | 92.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 888.83 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|