C8H13NO — CID 15346845
(1R,8R)-7-methyl-2,3,5,8-tetrahydro-1H-pyrrolizin-1-ol (PubChem CID 15346845) has the molecular formula C8H13NO and a molecular weight of 139.20 g/mol. Its IUPAC name is (1R,8R)-7-methyl-2,3,5,8-tetrahydro-1H-pyrrolizin-1-ol.
| Compound Name | (1R,8R)-7-methyl-2,3,5,8-tetrahydro-1H-pyrrolizin-1-ol |
|---|---|
| PubChem CID | 15346845 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | (1R,8R)-7-methyl-2,3,5,8-tetrahydro-1H-pyrrolizin-1-ol |
| SMILES | CC1=CCN2CC[C@@H](O)[C@@H]12 |
| InChI | InChI=1S/C8H13NO/c1-6-2-4-9-5-3-7(10)8(6)9/h2,7-8,10H,3-5H2,1H3/t7-,8-/m1/s1 |
| InChIKey | WZHPCLWXQJYMIQ-HTQZYQBOSA-N |
| XLogP | 0.38 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|