C21H29N7O6+2 — CID 153469346
(3aS,9S,10aS)-2,6-diamino-9-[(4,4-dimethyl-2,3-dihydrochromene-8-carbonyl)amino]-10,10-dihydroxy-1,3a,4,5,8,9-hexahydropyrrolo[1,2-c]purine-3,7-diium-4-carboxylic acid (PubChem CID 153469346) has the molecular formula C21H29N7O6+2 and a molecular weight of 475.51 g/mol. Its IUPAC name is (3aS,9S,10aS)-2,6-diamino-9-[(4,4-dimethyl-2,3-dihydrochromene-8-carbonyl)amino]-10,10-dihydroxy-1,3a,4,5,8,9-hexahydropyrrolo[1,2-c]purine-3,7-diium-4-carboxylic acid.
| Compound Name | (3aS,9S,10aS)-2,6-diamino-9-[(4,4-dimethyl-2,3-dihydrochromene-8-carbonyl)amino]-10,10-dihydroxy-1,3a,4,5,8,9-hexahydropyrrolo[1,2-c]purine-3,7-diium-4-carboxylic acid |
|---|---|
| PubChem CID | 153469346 |
| Molecular Formula | C21H29N7O6+2 |
| Molecular Weight | 475.51 g/mol |
| Exact Mass | 475.22 |
| IUPAC Name | (3aS,9S,10aS)-2,6-diamino-9-[(4,4-dimethyl-2,3-dihydrochromene-8-carbonyl)amino]-10,10-dihydroxy-1,3a,4,5,8,9-hexahydropyrrolo[1,2-c]purine-3,7-diium-4-carboxylic acid |
| SMILES | CC1(C)CCOc2c(C(=O)N[C@H]3C[N+]4=C(N)NC(C(=O)O)[C@@H]5[NH+]=C(N)N[C@@]54C3(O)O)cccc21 |
| InChI | InChI=1S/C21H27N7O6/c1-19(2)6-7-34-13-9(4-3-5-10(13)19)15(29)24-11-8-28-18(23)25-12(16(30)31)14-20(28,21(11,32)33)27-17(22)26-14/h3-5,11-12,14,32-33H,6-8H2,1-2H3,(H7,22,23,24,25,26,27,29,30,31)/p+2/t11-,12?,14-,20-/m0/s1 |
| InChIKey | NUHDECFWOAVNEV-BAHGNPKDSA-P |
| XLogP | -5.01 |
| TPSA | 209.17 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.51 |
| LogP ≤ 5 | -5.01 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|