C16H18N6O6 — CID 153469370
(3aS,4R,9S,10aS)-2,6-diamino-9-benzoyloxy-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purine-4-carboxylic acid (PubChem CID 153469370) has the molecular formula C16H18N6O6 and a molecular weight of 390.36 g/mol. Its IUPAC name is (3aS,4R,9S,10aS)-2,6-diamino-9-benzoyloxy-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purine-4-carboxylic acid.
| Compound Name | (3aS,4R,9S,10aS)-2,6-diamino-9-benzoyloxy-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purine-4-carboxylic acid |
|---|---|
| PubChem CID | 153469370 |
| Molecular Formula | C16H18N6O6 |
| Molecular Weight | 390.36 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | (3aS,4R,9S,10aS)-2,6-diamino-9-benzoyloxy-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purine-4-carboxylic acid |
| SMILES | NC1=N[C@H]2[C@H](C(=O)O)N=C(N)N3C[C@H](OC(=O)c4ccccc4)C(O)(O)[C@]23N1 |
| InChI | InChI=1S/C16H18N6O6/c17-13-20-10-9(11(23)24)19-14(18)22-6-8(16(26,27)15(10,22)21-13)28-12(25)7-4-2-1-3-5-7/h1-5,8-10,26-27H,6H2,(H2,18,19)(H,23,24)(H3,17,20,21)/t8-,9+,10-,15-/m0/s1 |
| InChIKey | GXQODVAZRZCUHG-OFYUCFFLSA-N |
| XLogP | -3.03 |
| TPSA | 196.09 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.36 |
| LogP ≤ 5 | -3.03 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|