C16H10ClF7N2O5 — CID 15346943
2-[[7-chloro-6-(2,2,3,3,4,4,4-heptafluorobutoxy)-3-hydroxyquinoline-2-carbonyl]amino]acetic acid (PubChem CID 15346943) has the molecular formula C16H10ClF7N2O5 and a molecular weight of 478.70 g/mol. Its IUPAC name is 2-[[7-chloro-6-(2,2,3,3,4,4,4-heptafluorobutoxy)-3-hydroxyquinoline-2-carbonyl]amino]acetic acid.
| Compound Name | 2-[[7-chloro-6-(2,2,3,3,4,4,4-heptafluorobutoxy)-3-hydroxyquinoline-2-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 15346943 |
| Molecular Formula | C16H10ClF7N2O5 |
| Molecular Weight | 478.70 g/mol |
| Exact Mass | 478.02 |
| IUPAC Name | 2-[[7-chloro-6-(2,2,3,3,4,4,4-heptafluorobutoxy)-3-hydroxyquinoline-2-carbonyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)c1nc2cc(Cl)c(OCC(F)(F)C(F)(F)C(F)(F)F)cc2cc1O |
| InChI | InChI=1S/C16H10ClF7N2O5/c17-7-3-8-6(1-9(27)12(26-8)13(30)25-4-11(28)29)2-10(7)31-5-14(18,19)15(20,21)16(22,23)24/h1-3,27H,4-5H2,(H,25,30)(H,28,29) |
| InChIKey | SITDWEOIWWNTMZ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.70 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|