About 3-ethyl-5,7-dihydro-4H-purine-2,6-dione
3-ethyl-5,7-dihydro-4H-purine-2,6-dione (PubChem CID 15346966) has the molecular formula C7H10N4O2
and a molecular weight of 182.18 g/mol. Its IUPAC name is 3-ethyl-5,7-dihydro-4H-purine-2,6-dione.
Molecular Properties
| Compound Name | 3-ethyl-5,7-dihydro-4H-purine-2,6-dione |
| PubChem CID | 15346966 |
| Molecular Formula | C7H10N4O2 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | 3-ethyl-5,7-dihydro-4H-purine-2,6-dione |
| SMILES | CCN1C(=O)NC(=O)C2NC=NC21 |
| InChI | InChI=1S/C7H10N4O2/c1-2-11-5-4(8-3-9-5)6(12)10-7(11)13/h3-5H,2H2,1H3,(H,8,9)(H,10,12,13) |
| InChIKey | YVTTZMZBIHPBGT-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-ethyl-5,7-dihydro-4H-purine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-5,7-dihydro-4H-purine-2,6-dione?
The IUPAC name of 3-ethyl-5,7-dihydro-4H-purine-2,6-dione (CID 15346966) is 3-ethyl-5,7-dihydro-4H-purine-2,6-dione.
What is the SMILES notation for 3-ethyl-5,7-dihydro-4H-purine-2,6-dione?
The canonical SMILES for 3-ethyl-5,7-dihydro-4H-purine-2,6-dione is CCN1C(=O)NC(=O)C2NC=NC21.
What is the InChIKey of 3-ethyl-5,7-dihydro-4H-purine-2,6-dione?
The InChIKey is YVTTZMZBIHPBGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N4O2/c1-2-11-5-4(8-3-9-5)6(12)10-7(11)13/h3-5H,2H2,1H3,(H,8,9)(H,10,12,13).
What are the key properties of 3-ethyl-5,7-dihydro-4H-purine-2,6-dione?
3-ethyl-5,7-dihydro-4H-purine-2,6-dione has a molecular weight of 182.18 g/mol, XLogP of -1.12, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-5,7-dihydro-4H-purine-2,6-dione is sourced from PubChem (CID 15346966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).