C12H35NO3SSi3 — CID 153469765
3-[[dimethyl(trimethylsilyloxy)silyl]oxy-methyl-trimethylsilyloxy-λ4-sulfanyl]propan-1-amine (PubChem CID 153469765) has the molecular formula C12H35NO3SSi3 and a molecular weight of 357.74 g/mol. Its IUPAC name is 3-[[dimethyl(trimethylsilyloxy)silyl]oxy-methyl-trimethylsilyloxy-λ4-sulfanyl]propan-1-amine.
| Compound Name | 3-[[dimethyl(trimethylsilyloxy)silyl]oxy-methyl-trimethylsilyloxy-λ4-sulfanyl]propan-1-amine |
|---|---|
| PubChem CID | 153469765 |
| Molecular Formula | C12H35NO3SSi3 |
| Molecular Weight | 357.74 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 3-[[dimethyl(trimethylsilyloxy)silyl]oxy-methyl-trimethylsilyloxy-λ4-sulfanyl]propan-1-amine |
| SMILES | C[Si](C)(C)O[Si](C)(C)OS(C)(CCCN)O[Si](C)(C)C |
| InChI | InChI=1S/C12H35NO3SSi3/c1-17(12-10-11-13,14-18(2,3)4)15-20(8,9)16-19(5,6)7/h10-13H2,1-9H3 |
| InChIKey | XJCXMDAEZUIXFD-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.74 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|