About ethyl 2-[4-[6,8-difluoro-5-(hexylamino)-4-oxochromen-2-yl]-2-fluoroanilino]acetate
ethyl 2-[4-[6,8-difluoro-5-(hexylamino)-4-oxochromen-2-yl]-2-fluoroanilino]acetate (PubChem CID 15347015) has the molecular formula C25H27F3N2O4
and a molecular weight of 476.50 g/mol. Its IUPAC name is ethyl 2-[4-[6,8-difluoro-5-(hexylamino)-4-oxochromen-2-yl]-2-fluoroanilino]acetate.
Molecular Properties
| Compound Name | ethyl 2-[4-[6,8-difluoro-5-(hexylamino)-4-oxochromen-2-yl]-2-fluoroanilino]acetate |
| PubChem CID | 15347015 |
| Molecular Formula | C25H27F3N2O4 |
| Molecular Weight | 476.50 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | ethyl 2-[4-[6,8-difluoro-5-(hexylamino)-4-oxochromen-2-yl]-2-fluoroanilino]acetate |
| SMILES | CCCCCCNc1c(F)cc(F)c2oc(-c3ccc(NCC(=O)OCC)c(F)c3)cc(=O)c12 |
| InChI | InChI=1S/C25H27F3N2O4/c1-3-5-6-7-10-29-24-17(27)12-18(28)25-23(24)20(31)13-21(34-25)15-8-9-19(16(26)11-15)30-14-22(32)33-4-2/h8-9,11-13,29-30H,3-7,10,14H2,1-2H3 |
| InChIKey | RGLOEVLYKKQDLW-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 476.50 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[4-[6,8-difluoro-5-(hexylamino)-4-oxochromen-2-yl]-2-fluoroanilino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[4-[6,8-difluoro-5-(hexylamino)-4-oxochromen-2-yl]-2-fluoroanilino]acetate?
The IUPAC name of ethyl 2-[4-[6,8-difluoro-5-(hexylamino)-4-oxochromen-2-yl]-2-fluoroanilino]acetate (CID 15347015) is ethyl 2-[4-[6,8-difluoro-5-(hexylamino)-4-oxochromen-2-yl]-2-fluoroanilino]acetate.
What is the SMILES notation for ethyl 2-[4-[6,8-difluoro-5-(hexylamino)-4-oxochromen-2-yl]-2-fluoroanilino]acetate?
The canonical SMILES for ethyl 2-[4-[6,8-difluoro-5-(hexylamino)-4-oxochromen-2-yl]-2-fluoroanilino]acetate is CCCCCCNc1c(F)cc(F)c2oc(-c3ccc(NCC(=O)OCC)c(F)c3)cc(=O)c12.
What is the InChIKey of ethyl 2-[4-[6,8-difluoro-5-(hexylamino)-4-oxochromen-2-yl]-2-fluoroanilino]acetate?
The InChIKey is RGLOEVLYKKQDLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H27F3N2O4/c1-3-5-6-7-10-29-24-17(27)12-18(28)25-23(24)20(31)13-21(34-25)15-8-9-19(16(26)11-15)30-14-22(32)33-4-2/h8-9,11-13,29-30H,3-7,10,14H2,1-2H3.
What are the key properties of ethyl 2-[4-[6,8-difluoro-5-(hexylamino)-4-oxochromen-2-yl]-2-fluoroanilino]acetate?
ethyl 2-[4-[6,8-difluoro-5-(hexylamino)-4-oxochromen-2-yl]-2-fluoroanilino]acetate has a molecular weight of 476.50 g/mol, XLogP of 5.84, 11 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[4-[6,8-difluoro-5-(hexylamino)-4-oxochromen-2-yl]-2-fluoroanilino]acetate is sourced from PubChem (CID 15347015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).