About potassium;(5,7-dimethylpyrrolo[2,3-d]pyrimidin-4-yl)methanone;hydroxide
potassium;(5,7-dimethylpyrrolo[2,3-d]pyrimidin-4-yl)methanone;hydroxide (PubChem CID 153470288) has the molecular formula C9H9KN3O2-
and a molecular weight of 230.29 g/mol. Its IUPAC name is potassium;(5,7-dimethylpyrrolo[2,3-d]pyrimidin-4-yl)methanone;hydroxide.
Molecular Properties
| Compound Name | potassium;(5,7-dimethylpyrrolo[2,3-d]pyrimidin-4-yl)methanone;hydroxide |
| PubChem CID | 153470288 |
| Molecular Formula | C9H9KN3O2- |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.03 |
| IUPAC Name | potassium;(5,7-dimethylpyrrolo[2,3-d]pyrimidin-4-yl)methanone;hydroxide |
| SMILES | Cc1cn(C)c2ncnc([C-]=O)c12.[K+].[OH-] |
| InChI | InChI=1S/C9H8N3O.K.H2O/c1-6-3-12(2)9-8(6)7(4-13)10-5-11-9;;/h3,5H,1-2H3;;1H2/q-1;+1;/p-1 |
| InChIKey | GYCXCHIESDNWJA-UHFFFAOYSA-M |
| XLogP | -2.44 |
| TPSA | 77.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | -2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze potassium;(5,7-dimethylpyrrolo[2,3-d]pyrimidin-4-yl)methanone;hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;(5,7-dimethylpyrrolo[2,3-d]pyrimidin-4-yl)methanone;hydroxide?
The IUPAC name of potassium;(5,7-dimethylpyrrolo[2,3-d]pyrimidin-4-yl)methanone;hydroxide (CID 153470288) is potassium;(5,7-dimethylpyrrolo[2,3-d]pyrimidin-4-yl)methanone;hydroxide.
What is the SMILES notation for potassium;(5,7-dimethylpyrrolo[2,3-d]pyrimidin-4-yl)methanone;hydroxide?
The canonical SMILES for potassium;(5,7-dimethylpyrrolo[2,3-d]pyrimidin-4-yl)methanone;hydroxide is Cc1cn(C)c2ncnc([C-]=O)c12.[K+].[OH-].
What is the InChIKey of potassium;(5,7-dimethylpyrrolo[2,3-d]pyrimidin-4-yl)methanone;hydroxide?
The InChIKey is GYCXCHIESDNWJA-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H8N3O.K.H2O/c1-6-3-12(2)9-8(6)7(4-13)10-5-11-9;;/h3,5H,1-2H3;;1H2/q-1;+1;/p-1.
What are the key properties of potassium;(5,7-dimethylpyrrolo[2,3-d]pyrimidin-4-yl)methanone;hydroxide?
potassium;(5,7-dimethylpyrrolo[2,3-d]pyrimidin-4-yl)methanone;hydroxide has a molecular weight of 230.29 g/mol, XLogP of -2.44, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;(5,7-dimethylpyrrolo[2,3-d]pyrimidin-4-yl)methanone;hydroxide is sourced from PubChem (CID 153470288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).