C19H22F3N3O5S — CID 153470322
tert-butyl (7S)-7-methyl-2-phenyl-3-(trifluoromethylsulfonyloxy)-5,7-dihydro-4H-pyrazolo[3,4-c]pyridine-6-carboxylate (PubChem CID 153470322) has the molecular formula C19H22F3N3O5S and a molecular weight of 461.46 g/mol. Its IUPAC name is tert-butyl (7S)-7-methyl-2-phenyl-3-(trifluoromethylsulfonyloxy)-5,7-dihydro-4H-pyrazolo[3,4-c]pyridine-6-carboxylate.
| Compound Name | tert-butyl (7S)-7-methyl-2-phenyl-3-(trifluoromethylsulfonyloxy)-5,7-dihydro-4H-pyrazolo[3,4-c]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 153470322 |
| Molecular Formula | C19H22F3N3O5S |
| Molecular Weight | 461.46 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | tert-butyl (7S)-7-methyl-2-phenyl-3-(trifluoromethylsulfonyloxy)-5,7-dihydro-4H-pyrazolo[3,4-c]pyridine-6-carboxylate |
| SMILES | C[C@H]1c2nn(-c3ccccc3)c(OS(=O)(=O)C(F)(F)F)c2CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H22F3N3O5S/c1-12-15-14(10-11-24(12)17(26)29-18(2,3)4)16(30-31(27,28)19(20,21)22)25(23-15)13-8-6-5-7-9-13/h5-9,12H,10-11H2,1-4H3/t12-/m0/s1 |
| InChIKey | IRDJIUUELJRSNQ-LBPRGKRZSA-N |
| XLogP | 3.95 |
| TPSA | 90.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.46 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|