C20H22F3N3O2 — CID 153470587
tert-butyl (1S,8R)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,11-triazatricyclo[6.2.1.02,6]undeca-2,5-diene-11-carboxylate (PubChem CID 153470587) has the molecular formula C20H22F3N3O2 and a molecular weight of 393.41 g/mol. Its IUPAC name is tert-butyl (1S,8R)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,11-triazatricyclo[6.2.1.02,6]undeca-2,5-diene-11-carboxylate.
| Compound Name | tert-butyl (1S,8R)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,11-triazatricyclo[6.2.1.02,6]undeca-2,5-diene-11-carboxylate |
|---|---|
| PubChem CID | 153470587 |
| Molecular Formula | C20H22F3N3O2 |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | tert-butyl (1S,8R)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,11-triazatricyclo[6.2.1.02,6]undeca-2,5-diene-11-carboxylate |
| SMILES | Cn1nc2c(c1-c1cc(F)c(F)c(F)c1)C[C@H]1CC[C@@H]2N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H22F3N3O2/c1-20(2,3)28-19(27)26-11-5-6-15(26)17-12(9-11)18(25(4)24-17)10-7-13(21)16(23)14(22)8-10/h7-8,11,15H,5-6,9H2,1-4H3/t11-,15+/m1/s1 |
| InChIKey | DWQACHBIUFKCKD-ABAIWWIYSA-N |
| XLogP | 4.50 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|