C24H22ClN7O — CID 153470628
[5-(3-chlorophenyl)-4-methyl-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-(1-pyridin-2-yl-1,2,4-triazol-3-yl)methanone (PubChem CID 153470628) has the molecular formula C24H22ClN7O and a molecular weight of 459.94 g/mol. Its IUPAC name is [5-(3-chlorophenyl)-4-methyl-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-(1-pyridin-2-yl-1,2,4-triazol-3-yl)methanone.
| Compound Name | [5-(3-chlorophenyl)-4-methyl-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-(1-pyridin-2-yl-1,2,4-triazol-3-yl)methanone |
|---|---|
| PubChem CID | 153470628 |
| Molecular Formula | C24H22ClN7O |
| Molecular Weight | 459.94 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | [5-(3-chlorophenyl)-4-methyl-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-(1-pyridin-2-yl-1,2,4-triazol-3-yl)methanone |
| SMILES | Cn1nc2c(c1-c1cccc(Cl)c1)CC1CCCC2N1C(=O)c1ncn(-c2ccccn2)n1 |
| InChI | InChI=1S/C24H22ClN7O/c1-30-22(15-6-4-7-16(25)12-15)18-13-17-8-5-9-19(21(18)28-30)32(17)24(33)23-27-14-31(29-23)20-10-2-3-11-26-20/h2-4,6-7,10-12,14,17,19H,5,8-9,13H2,1H3 |
| InChIKey | BMSXZRYLHKDJFO-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 81.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.94 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |