C13H20BFN2O4S — CID 153470737
1-[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]ethanesulfonamide (PubChem CID 153470737) has the molecular formula C13H20BFN2O4S and a molecular weight of 330.19 g/mol. Its IUPAC name is 1-[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]ethanesulfonamide.
| Compound Name | 1-[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]ethanesulfonamide |
|---|---|
| PubChem CID | 153470737 |
| Molecular Formula | C13H20BFN2O4S |
| Molecular Weight | 330.19 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 1-[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]ethanesulfonamide |
| SMILES | CC(c1cc(B2OC(C)(C)C(C)(C)O2)cnc1F)S(N)(=O)=O |
| InChI | InChI=1S/C13H20BFN2O4S/c1-8(22(16,18)19)10-6-9(7-17-11(10)15)14-20-12(2,3)13(4,5)21-14/h6-8H,1-5H3,(H2,16,18,19) |
| InChIKey | PQZAFLCUDCVYBZ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 91.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.19 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|