C21H11F4I4O9S- — CID 153471596
4-[4-(2-carboxy-3,4,5,6-tetraiodobenzoyl)oxycyclohexanecarbonyl]oxy-2,3,5,6-tetrafluorobenzenesulfonate (PubChem CID 153471596) has the molecular formula C21H11F4I4O9S- and a molecular weight of 1022.98 g/mol. Its IUPAC name is 4-[4-(2-carboxy-3,4,5,6-tetraiodobenzoyl)oxycyclohexanecarbonyl]oxy-2,3,5,6-tetrafluorobenzenesulfonate.
| Compound Name | 4-[4-(2-carboxy-3,4,5,6-tetraiodobenzoyl)oxycyclohexanecarbonyl]oxy-2,3,5,6-tetrafluorobenzenesulfonate |
|---|---|
| PubChem CID | 153471596 |
| Molecular Formula | C21H11F4I4O9S- |
| Molecular Weight | 1022.98 g/mol |
| Exact Mass | 1022.62 |
| IUPAC Name | 4-[4-(2-carboxy-3,4,5,6-tetraiodobenzoyl)oxycyclohexanecarbonyl]oxy-2,3,5,6-tetrafluorobenzenesulfonate |
| SMILES | O=C(O)c1c(I)c(I)c(I)c(I)c1C(=O)OC1CCC(C(=O)Oc2c(F)c(F)c(S(=O)(=O)[O-])c(F)c2F)CC1 |
| InChI | InChI=1S/C21H12F4I4O9S/c22-9-11(24)18(39(34,35)36)12(25)10(23)17(9)38-20(32)5-1-3-6(4-2-5)37-21(33)8-7(19(30)31)13(26)15(28)16(29)14(8)27/h5-6H,1-4H2,(H,30,31)(H,34,35,36)/p-1 |
| InChIKey | KKZQPKBUMSSWHQ-UHFFFAOYSA-M |
| XLogP | 5.58 |
| TPSA | 147.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1022.98 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|