C13H4F4IO6S- — CID 153471644
2,3,5,6-tetrafluoro-4-(3-hydroxy-4-iodobenzoyl)oxybenzenesulfonate (PubChem CID 153471644) has the molecular formula C13H4F4IO6S- and a molecular weight of 491.13 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-(3-hydroxy-4-iodobenzoyl)oxybenzenesulfonate.
| Compound Name | 2,3,5,6-tetrafluoro-4-(3-hydroxy-4-iodobenzoyl)oxybenzenesulfonate |
|---|---|
| PubChem CID | 153471644 |
| Molecular Formula | C13H4F4IO6S- |
| Molecular Weight | 491.13 g/mol |
| Exact Mass | 490.87 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-(3-hydroxy-4-iodobenzoyl)oxybenzenesulfonate |
| SMILES | O=C(Oc1c(F)c(F)c(S(=O)(=O)[O-])c(F)c1F)c1ccc(I)c(O)c1 |
| InChI | InChI=1S/C13H5F4IO6S/c14-7-9(16)12(25(21,22)23)10(17)8(15)11(7)24-13(20)4-1-2-5(18)6(19)3-4/h1-3,19H,(H,21,22,23)/p-1 |
| InChIKey | FESWMDZWMCURBN-UHFFFAOYSA-M |
| XLogP | 2.68 |
| TPSA | 103.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.13 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|