C58H68B2N2O4 — CID 153472883
7-[2,5-dihexyl-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazol-9-yl]phenyl]-10-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[c]carbazole (PubChem CID 153472883) has the molecular formula C58H68B2N2O4 and a molecular weight of 878.82 g/mol. Its IUPAC name is 7-[2,5-dihexyl-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazol-9-yl]phenyl]-10-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[c]carbazole.
| Compound Name | 7-[2,5-dihexyl-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazol-9-yl]phenyl]-10-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[c]carbazole |
|---|---|
| PubChem CID | 153472883 |
| Molecular Formula | C58H68B2N2O4 |
| Molecular Weight | 878.82 g/mol |
| Exact Mass | 878.54 |
| IUPAC Name | 7-[2,5-dihexyl-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazol-9-yl]phenyl]-10-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[c]carbazole |
| SMILES | CCCCCCc1cc(-n2c3ccc(B4OC(C)(C)C(C)(C)O4)cc3c3c4ccccc4ccc32)c(CCCCCC)cc1-n1c2ccccc2c2cc(B3OC(C)(C)C(C)(C)O3)ccc21 |
| InChI | InChI=1S/C58H68B2N2O4/c1-11-13-15-17-24-40-36-53(62-50-34-31-43(60-65-57(7,8)58(9,10)66-60)38-47(50)54-44-26-20-19-23-39(44)29-32-51(54)62)41(25-18-16-14-12-2)35-52(40)61-48-28-22-21-27-45(48)46-37-42(30-33-49(46)61)59-63-55(3,4)56(5,6)64-59/h19-23,26-38H,11-18,24-25H2,1-10H3 |
| InChIKey | IQZBSEDORNEKGL-UHFFFAOYSA-N |
| XLogP | 13.88 |
| TPSA | 46.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 878.82 |
| LogP ≤ 5 | 13.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|