C17H25N2O2+ — CID 153473060
1-butyl-3-[(3,5-dimethoxyphenyl)methyl]-2-methylimidazol-3-ium (PubChem CID 153473060) has the molecular formula C17H25N2O2+ and a molecular weight of 289.40 g/mol. Its IUPAC name is 1-butyl-3-[(3,5-dimethoxyphenyl)methyl]-2-methylimidazol-3-ium.
| Compound Name | 1-butyl-3-[(3,5-dimethoxyphenyl)methyl]-2-methylimidazol-3-ium |
|---|---|
| PubChem CID | 153473060 |
| Molecular Formula | C17H25N2O2+ |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.19 |
| IUPAC Name | 1-butyl-3-[(3,5-dimethoxyphenyl)methyl]-2-methylimidazol-3-ium |
| SMILES | CCCCn1cc[n+](Cc2cc(OC)cc(OC)c2)c1C |
| InChI | InChI=1S/C17H25N2O2/c1-5-6-7-18-8-9-19(14(18)2)13-15-10-16(20-3)12-17(11-15)21-4/h8-12H,5-7,13H2,1-4H3/q+1 |
| InChIKey | RORQUAFCNNOXCG-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 27.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|