C20H33Cl2N3O2 — CID 153473321
(3S)-4-[(4-chlorocyclohexyl)methyl]-1-(5-chloro-3-methylpiperidin-2-yl)-3-propan-2-ylpiperazine-2,5-dione (PubChem CID 153473321) has the molecular formula C20H33Cl2N3O2 and a molecular weight of 418.41 g/mol. Its IUPAC name is (3S)-4-[(4-chlorocyclohexyl)methyl]-1-(5-chloro-3-methylpiperidin-2-yl)-3-propan-2-ylpiperazine-2,5-dione.
| Compound Name | (3S)-4-[(4-chlorocyclohexyl)methyl]-1-(5-chloro-3-methylpiperidin-2-yl)-3-propan-2-ylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 153473321 |
| Molecular Formula | C20H33Cl2N3O2 |
| Molecular Weight | 418.41 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | (3S)-4-[(4-chlorocyclohexyl)methyl]-1-(5-chloro-3-methylpiperidin-2-yl)-3-propan-2-ylpiperazine-2,5-dione |
| SMILES | CC1CC(Cl)CNC1N1CC(=O)N(CC2CCC(Cl)CC2)[C@@H](C(C)C)C1=O |
| InChI | InChI=1S/C20H33Cl2N3O2/c1-12(2)18-20(27)25(19-13(3)8-16(22)9-23-19)11-17(26)24(18)10-14-4-6-15(21)7-5-14/h12-16,18-19,23H,4-11H2,1-3H3/t13?,14?,15?,16?,18-,19?/m0/s1 |
| InChIKey | PNUNPVGOLYAXAC-CAWLCXJGSA-N |
| XLogP | 3.04 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.41 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|