C23H21F4N5O4 — CID 153473347
4-[2-acetyl-6,9-dioxo-5-[[4-(trifluoromethyl)phenyl]methyl]-2,5,8-triazaspiro[3.5]nonan-8-yl]-3-fluoro-N'-hydroxybenzenecarboximidamide (PubChem CID 153473347) has the molecular formula C23H21F4N5O4 and a molecular weight of 507.44 g/mol. Its IUPAC name is 4-[2-acetyl-6,9-dioxo-5-[[4-(trifluoromethyl)phenyl]methyl]-2,5,8-triazaspiro[3.5]nonan-8-yl]-3-fluoro-N'-hydroxybenzenecarboximidamide.
| Compound Name | 4-[2-acetyl-6,9-dioxo-5-[[4-(trifluoromethyl)phenyl]methyl]-2,5,8-triazaspiro[3.5]nonan-8-yl]-3-fluoro-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 153473347 |
| Molecular Formula | C23H21F4N5O4 |
| Molecular Weight | 507.44 g/mol |
| Exact Mass | 507.15 |
| IUPAC Name | 4-[2-acetyl-6,9-dioxo-5-[[4-(trifluoromethyl)phenyl]methyl]-2,5,8-triazaspiro[3.5]nonan-8-yl]-3-fluoro-N'-hydroxybenzenecarboximidamide |
| SMILES | CC(=O)N1CC2(C1)C(=O)N(c1ccc(/C(N)=N\O)cc1F)CC(=O)N2Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H21F4N5O4/c1-13(33)30-11-22(12-30)21(35)31(18-7-4-15(8-17(18)24)20(28)29-36)10-19(34)32(22)9-14-2-5-16(6-3-14)23(25,26)27/h2-8,36H,9-12H2,1H3,(H2,28,29) |
| InChIKey | UKNGZQPNRQDOEI-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 119.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.44 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|