C24H26FN5O4 — CID 153474542
[(2R,3S)-3-hydroxy-2,3-dimethylcyclobutyl] N-[8-amino-7-fluoro-6-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)isoquinolin-3-yl]carbamate (PubChem CID 153474542) has the molecular formula C24H26FN5O4 and a molecular weight of 467.50 g/mol. Its IUPAC name is [(2R,3S)-3-hydroxy-2,3-dimethylcyclobutyl] N-[8-amino-7-fluoro-6-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)isoquinolin-3-yl]carbamate.
| Compound Name | [(2R,3S)-3-hydroxy-2,3-dimethylcyclobutyl] N-[8-amino-7-fluoro-6-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)isoquinolin-3-yl]carbamate |
|---|---|
| PubChem CID | 153474542 |
| Molecular Formula | C24H26FN5O4 |
| Molecular Weight | 467.50 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | [(2R,3S)-3-hydroxy-2,3-dimethylcyclobutyl] N-[8-amino-7-fluoro-6-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)isoquinolin-3-yl]carbamate |
| SMILES | Cc1c(-c2cc3cc(NC(=O)OC4C[C@](C)(O)[C@@H]4C)ncc3c(N)c2F)cnc2c1NCCO2 |
| InChI | InChI=1S/C24H26FN5O4/c1-11-15(9-29-22-21(11)27-4-5-33-22)14-6-13-7-18(28-10-16(13)20(26)19(14)25)30-23(31)34-17-8-24(3,32)12(17)2/h6-7,9-10,12,17,27,32H,4-5,8,26H2,1-3H3,(H,28,30,31)/t12-,17?,24+/m1/s1 |
| InChIKey | AHWWNFZVELBJCP-YRVIQACOSA-N |
| XLogP | 3.84 |
| TPSA | 131.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.50 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|