About 7-(2,2-difluoroethyl)-9-propan-2-yl-3-oxa-7-azabicyclo[3.3.1]nonane
7-(2,2-difluoroethyl)-9-propan-2-yl-3-oxa-7-azabicyclo[3.3.1]nonane (PubChem CID 153474577) has the molecular formula C12H21F2NO
and a molecular weight of 233.30 g/mol. Its IUPAC name is 7-(2,2-difluoroethyl)-9-propan-2-yl-3-oxa-7-azabicyclo[3.3.1]nonane.
Molecular Properties
| Compound Name | 7-(2,2-difluoroethyl)-9-propan-2-yl-3-oxa-7-azabicyclo[3.3.1]nonane |
| PubChem CID | 153474577 |
| Molecular Formula | C12H21F2NO |
| Molecular Weight | 233.30 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | 7-(2,2-difluoroethyl)-9-propan-2-yl-3-oxa-7-azabicyclo[3.3.1]nonane |
| SMILES | CC(C)C1C2COCC1CN(CC(F)F)C2 |
| InChI | InChI=1S/C12H21F2NO/c1-8(2)12-9-3-15(5-11(13)14)4-10(12)7-16-6-9/h8-12H,3-7H2,1-2H3 |
| InChIKey | NGCPDWLXAYISFD-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.30 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-(2,2-difluoroethyl)-9-propan-2-yl-3-oxa-7-azabicyclo[3.3.1]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(2,2-difluoroethyl)-9-propan-2-yl-3-oxa-7-azabicyclo[3.3.1]nonane?
The IUPAC name of 7-(2,2-difluoroethyl)-9-propan-2-yl-3-oxa-7-azabicyclo[3.3.1]nonane (CID 153474577) is 7-(2,2-difluoroethyl)-9-propan-2-yl-3-oxa-7-azabicyclo[3.3.1]nonane.
What is the SMILES notation for 7-(2,2-difluoroethyl)-9-propan-2-yl-3-oxa-7-azabicyclo[3.3.1]nonane?
The canonical SMILES for 7-(2,2-difluoroethyl)-9-propan-2-yl-3-oxa-7-azabicyclo[3.3.1]nonane is CC(C)C1C2COCC1CN(CC(F)F)C2.
What is the InChIKey of 7-(2,2-difluoroethyl)-9-propan-2-yl-3-oxa-7-azabicyclo[3.3.1]nonane?
The InChIKey is NGCPDWLXAYISFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21F2NO/c1-8(2)12-9-3-15(5-11(13)14)4-10(12)7-16-6-9/h8-12H,3-7H2,1-2H3.
What are the key properties of 7-(2,2-difluoroethyl)-9-propan-2-yl-3-oxa-7-azabicyclo[3.3.1]nonane?
7-(2,2-difluoroethyl)-9-propan-2-yl-3-oxa-7-azabicyclo[3.3.1]nonane has a molecular weight of 233.30 g/mol, XLogP of 2.10, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(2,2-difluoroethyl)-9-propan-2-yl-3-oxa-7-azabicyclo[3.3.1]nonane is sourced from PubChem (CID 153474577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).