C46H28O — CID 153474851
1-[1,2,3,4,5,6,7,8-octadeuterio-10-(3-phenanthren-4-ylphenyl)anthracen-9-yl]dibenzofuran (PubChem CID 153474851) has the molecular formula C46H28O and a molecular weight of 604.78 g/mol. Its IUPAC name is 1-[1,2,3,4,5,6,7,8-octadeuterio-10-(3-phenanthren-4-ylphenyl)anthracen-9-yl]dibenzofuran.
| Compound Name | 1-[1,2,3,4,5,6,7,8-octadeuterio-10-(3-phenanthren-4-ylphenyl)anthracen-9-yl]dibenzofuran |
|---|---|
| PubChem CID | 153474851 |
| Molecular Formula | C46H28O |
| Molecular Weight | 604.78 g/mol |
| Exact Mass | 604.26 |
| IUPAC Name | 1-[1,2,3,4,5,6,7,8-octadeuterio-10-(3-phenanthren-4-ylphenyl)anthracen-9-yl]dibenzofuran |
| SMILES | [2H]c1c([2H])c([2H])c2c(-c3cccc4oc5ccccc5c34)c3c([2H])c([2H])c([2H])c([2H])c3c(-c3cccc(-c4cccc5ccc6ccccc6c45)c3)c2c1[2H] |
| InChI | InChI=1S/C46H28O/c1-2-16-33-29(12-1)26-27-30-13-10-22-34(43(30)33)31-14-9-15-32(28-31)44-35-17-3-5-19-37(35)45(38-20-6-4-18-36(38)44)40-23-11-25-42-46(40)39-21-7-8-24-41(39)47-42/h1-28H/i3D,4D,5D,6D,17D,18D,19D,20D |
| InChIKey | IAXCNEUCCOTLDZ-LVTYYKMKSA-N |
| XLogP | 13.20 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.78 |
| LogP ≤ 5 | 13.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|