C17H12S16 — CID 15347718
2,2'-bis[4,5-bis(methylsulfanyl)-1,3-dithiol-2-ylidene]-5,5'-spirobi[[1,3]dithiolo[4,5-d][1,3]dithiole] (PubChem CID 15347718) has the molecular formula C17H12S16 and a molecular weight of 729.35 g/mol. Its IUPAC name is 2,2'-bis[4,5-bis(methylsulfanyl)-1,3-dithiol-2-ylidene]-5,5'-spirobi[[1,3]dithiolo[4,5-d][1,3]dithiole].
| Compound Name | 2,2'-bis[4,5-bis(methylsulfanyl)-1,3-dithiol-2-ylidene]-5,5'-spirobi[[1,3]dithiolo[4,5-d][1,3]dithiole] |
|---|---|
| PubChem CID | 15347718 |
| Molecular Formula | C17H12S16 |
| Molecular Weight | 729.35 g/mol |
| Exact Mass | 727.65 |
| IUPAC Name | 2,2'-bis[4,5-bis(methylsulfanyl)-1,3-dithiol-2-ylidene]-5,5'-spirobi[[1,3]dithiolo[4,5-d][1,3]dithiole] |
| SMILES | CSC1=C(SC)SC(=C2SC3=C(S2)SC2(S3)SC3=C(SC(=C4SC(SC)=C(SC)S4)S3)S2)S1 |
| InChI | InChI=1S/C17H12S16/c1-18-5-6(19-2)23-9(22-5)11-26-13-14(27-11)31-17(30-13)32-15-16(33-17)29-12(28-15)10-24-7(20-3)8(21-4)25-10/h1-4H3 |
| InChIKey | KXSRPRCYADWISY-UHFFFAOYSA-N |
| XLogP | 12.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.35 |
| LogP ≤ 5 | 12.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |