About [3,5-dichloro-2-fluoro-4-(1-methyl-6-oxo-5-propan-2-ylpyridazin-3-yl)oxyphenyl]boronic acid
[3,5-dichloro-2-fluoro-4-(1-methyl-6-oxo-5-propan-2-ylpyridazin-3-yl)oxyphenyl]boronic acid (PubChem CID 153482951) has the molecular formula C14H14BCl2FN2O4
and a molecular weight of 374.99 g/mol. Its IUPAC name is [3,5-dichloro-2-fluoro-4-(1-methyl-6-oxo-5-propan-2-ylpyridazin-3-yl)oxyphenyl]boronic acid.
Molecular Properties
| Compound Name | [3,5-dichloro-2-fluoro-4-(1-methyl-6-oxo-5-propan-2-ylpyridazin-3-yl)oxyphenyl]boronic acid |
| PubChem CID | 153482951 |
| Molecular Formula | C14H14BCl2FN2O4 |
| Molecular Weight | 374.99 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | [3,5-dichloro-2-fluoro-4-(1-methyl-6-oxo-5-propan-2-ylpyridazin-3-yl)oxyphenyl]boronic acid |
| SMILES | CC(C)c1cc(Oc2c(Cl)cc(B(O)O)c(F)c2Cl)nn(C)c1=O |
| InChI | InChI=1S/C14H14BCl2FN2O4/c1-6(2)7-4-10(19-20(3)14(7)21)24-13-9(16)5-8(15(22)23)12(18)11(13)17/h4-6,22-23H,1-3H3 |
| InChIKey | JGLINZSUKOBEJI-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.99 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [3,5-dichloro-2-fluoro-4-(1-methyl-6-oxo-5-propan-2-ylpyridazin-3-yl)oxyphenyl]boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,5-dichloro-2-fluoro-4-(1-methyl-6-oxo-5-propan-2-ylpyridazin-3-yl)oxyphenyl]boronic acid?
The IUPAC name of [3,5-dichloro-2-fluoro-4-(1-methyl-6-oxo-5-propan-2-ylpyridazin-3-yl)oxyphenyl]boronic acid (CID 153482951) is [3,5-dichloro-2-fluoro-4-(1-methyl-6-oxo-5-propan-2-ylpyridazin-3-yl)oxyphenyl]boronic acid.
What is the SMILES notation for [3,5-dichloro-2-fluoro-4-(1-methyl-6-oxo-5-propan-2-ylpyridazin-3-yl)oxyphenyl]boronic acid?
The canonical SMILES for [3,5-dichloro-2-fluoro-4-(1-methyl-6-oxo-5-propan-2-ylpyridazin-3-yl)oxyphenyl]boronic acid is CC(C)c1cc(Oc2c(Cl)cc(B(O)O)c(F)c2Cl)nn(C)c1=O.
What is the InChIKey of [3,5-dichloro-2-fluoro-4-(1-methyl-6-oxo-5-propan-2-ylpyridazin-3-yl)oxyphenyl]boronic acid?
The InChIKey is JGLINZSUKOBEJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14BCl2FN2O4/c1-6(2)7-4-10(19-20(3)14(7)21)24-13-9(16)5-8(15(22)23)12(18)11(13)17/h4-6,22-23H,1-3H3.
What are the key properties of [3,5-dichloro-2-fluoro-4-(1-methyl-6-oxo-5-propan-2-ylpyridazin-3-yl)oxyphenyl]boronic acid?
[3,5-dichloro-2-fluoro-4-(1-methyl-6-oxo-5-propan-2-ylpyridazin-3-yl)oxyphenyl]boronic acid has a molecular weight of 374.99 g/mol, XLogP of 1.82, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3,5-dichloro-2-fluoro-4-(1-methyl-6-oxo-5-propan-2-ylpyridazin-3-yl)oxyphenyl]boronic acid is sourced from PubChem (CID 153482951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).