About N-[(2R,3S)-2-[[(4S)-4-(4-fluorophenyl)hexoxy]methyl]piperidin-3-yl]methanesulfonamide
N-[(2R,3S)-2-[[(4S)-4-(4-fluorophenyl)hexoxy]methyl]piperidin-3-yl]methanesulfonamide (PubChem CID 153483526) has the molecular formula C19H31FN2O3S
and a molecular weight of 386.53 g/mol. Its IUPAC name is N-[(2R,3S)-2-[[(4S)-4-(4-fluorophenyl)hexoxy]methyl]piperidin-3-yl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[(2R,3S)-2-[[(4S)-4-(4-fluorophenyl)hexoxy]methyl]piperidin-3-yl]methanesulfonamide |
| PubChem CID | 153483526 |
| Molecular Formula | C19H31FN2O3S |
| Molecular Weight | 386.53 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | N-[(2R,3S)-2-[[(4S)-4-(4-fluorophenyl)hexoxy]methyl]piperidin-3-yl]methanesulfonamide |
| SMILES | CCC(CCCOC[C@@H]1NCCC[C@@H]1NS(C)(=O)=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H31FN2O3S/c1-3-15(16-8-10-17(20)11-9-16)6-5-13-25-14-19-18(7-4-12-21-19)22-26(2,23)24/h8-11,15,18-19,21-22H,3-7,12-14H2,1-2H3/t15?,18-,19-/m0/s1 |
| InChIKey | KSGTWFKPEOZBKK-IROOXBOJSA-N |
| XLogP | 2.79 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.53 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[(2R,3S)-2-[[(4S)-4-(4-fluorophenyl)hexoxy]methyl]piperidin-3-yl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2R,3S)-2-[[(4S)-4-(4-fluorophenyl)hexoxy]methyl]piperidin-3-yl]methanesulfonamide?
The IUPAC name of N-[(2R,3S)-2-[[(4S)-4-(4-fluorophenyl)hexoxy]methyl]piperidin-3-yl]methanesulfonamide (CID 153483526) is N-[(2R,3S)-2-[[(4S)-4-(4-fluorophenyl)hexoxy]methyl]piperidin-3-yl]methanesulfonamide.
What is the SMILES notation for N-[(2R,3S)-2-[[(4S)-4-(4-fluorophenyl)hexoxy]methyl]piperidin-3-yl]methanesulfonamide?
The canonical SMILES for N-[(2R,3S)-2-[[(4S)-4-(4-fluorophenyl)hexoxy]methyl]piperidin-3-yl]methanesulfonamide is CCC(CCCOC[C@@H]1NCCC[C@@H]1NS(C)(=O)=O)c1ccc(F)cc1.
What is the InChIKey of N-[(2R,3S)-2-[[(4S)-4-(4-fluorophenyl)hexoxy]methyl]piperidin-3-yl]methanesulfonamide?
The InChIKey is KSGTWFKPEOZBKK-IROOXBOJSA-N. The full InChI is InChI=1S/C19H31FN2O3S/c1-3-15(16-8-10-17(20)11-9-16)6-5-13-25-14-19-18(7-4-12-21-19)22-26(2,23)24/h8-11,15,18-19,21-22H,3-7,12-14H2,1-2H3/t15?,18-,19-/m0/s1.
What are the key properties of N-[(2R,3S)-2-[[(4S)-4-(4-fluorophenyl)hexoxy]methyl]piperidin-3-yl]methanesulfonamide?
N-[(2R,3S)-2-[[(4S)-4-(4-fluorophenyl)hexoxy]methyl]piperidin-3-yl]methanesulfonamide has a molecular weight of 386.53 g/mol, XLogP of 2.79, 10 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2R,3S)-2-[[(4S)-4-(4-fluorophenyl)hexoxy]methyl]piperidin-3-yl]methanesulfonamide is sourced from PubChem (CID 153483526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).