C13H22BrN3O2Si — CID 153483586
2-[[5-bromo-3-(3,6-dihydro-2H-pyran-4-yl)-1,2,4-triazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 153483586) has the molecular formula C13H22BrN3O2Si and a molecular weight of 360.33 g/mol. Its IUPAC name is 2-[[5-bromo-3-(3,6-dihydro-2H-pyran-4-yl)-1,2,4-triazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[5-bromo-3-(3,6-dihydro-2H-pyran-4-yl)-1,2,4-triazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 153483586 |
| Molecular Formula | C13H22BrN3O2Si |
| Molecular Weight | 360.33 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | 2-[[5-bromo-3-(3,6-dihydro-2H-pyran-4-yl)-1,2,4-triazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1nc(C2=CCOCC2)nc1Br |
| InChI | InChI=1S/C13H22BrN3O2Si/c1-20(2,3)9-8-19-10-17-13(14)15-12(16-17)11-4-6-18-7-5-11/h4H,5-10H2,1-3H3 |
| InChIKey | XSHSZHDGGJOGNJ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.33 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|