C18H17N5O4 — CID 153484058
1-methyl-N-[3-(1,3-oxazol-2-ylmethylamino)-2,3-dioxopropyl]-3-phenylpyrazole-4-carboxamide (PubChem CID 153484058) has the molecular formula C18H17N5O4 and a molecular weight of 367.37 g/mol. Its IUPAC name is 1-methyl-N-[3-(1,3-oxazol-2-ylmethylamino)-2,3-dioxopropyl]-3-phenylpyrazole-4-carboxamide.
| Compound Name | 1-methyl-N-[3-(1,3-oxazol-2-ylmethylamino)-2,3-dioxopropyl]-3-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 153484058 |
| Molecular Formula | C18H17N5O4 |
| Molecular Weight | 367.37 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | 1-methyl-N-[3-(1,3-oxazol-2-ylmethylamino)-2,3-dioxopropyl]-3-phenylpyrazole-4-carboxamide |
| SMILES | Cn1cc(C(=O)NCC(=O)C(=O)NCc2ncco2)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C18H17N5O4/c1-23-11-13(16(22-23)12-5-3-2-4-6-12)17(25)20-9-14(24)18(26)21-10-15-19-7-8-27-15/h2-8,11H,9-10H2,1H3,(H,20,25)(H,21,26) |
| InChIKey | RFQPEMKNLIVZBP-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 119.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.37 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|