C39H51F3IrNO2- — CID 153484575
2-(4-cyclohexyl-1H-naphthalen-1-id-2-yl)-4-(3,3,3-trifluoro-2,2-dimethylpropyl)pyridine;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium (PubChem CID 153484575) has the molecular formula C39H51F3IrNO2- and a molecular weight of 815.05 g/mol. Its IUPAC name is 2-(4-cyclohexyl-1H-naphthalen-1-id-2-yl)-4-(3,3,3-trifluoro-2,2-dimethylpropyl)pyridine;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium.
| Compound Name | 2-(4-cyclohexyl-1H-naphthalen-1-id-2-yl)-4-(3,3,3-trifluoro-2,2-dimethylpropyl)pyridine;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium |
|---|---|
| PubChem CID | 153484575 |
| Molecular Formula | C39H51F3IrNO2- |
| Molecular Weight | 815.05 g/mol |
| Exact Mass | 815.35 |
| IUPAC Name | 2-(4-cyclohexyl-1H-naphthalen-1-id-2-yl)-4-(3,3,3-trifluoro-2,2-dimethylpropyl)pyridine;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium |
| SMILES | CC(C)(Cc1ccnc(-c2[c-]c3ccccc3c(C3CCCCC3)c2)c1)C(F)(F)F.CCC(CC)C(=O)/C=C(\O)C(CC)CC.[Ir] |
| InChI | InChI=1S/C26H27F3N.C13H24O2.Ir/c1-25(2,26(27,28)29)17-18-12-13-30-24(14-18)21-15-20-10-6-7-11-22(20)23(16-21)19-8-4-3-5-9-19;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h6-7,10-14,16,19H,3-5,8-9,17H2,1-2H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | HSYSAFJSFZRKOQ-DZTQYQPZSA-N |
| XLogP | 11.75 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.05 |
| LogP ≤ 5 | 11.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|