About iridium;2-methyl-6-pyridin-2-yl-7H-[1]benzofuro[2,3-b]pyridin-7-ide;2-phenylpyridine
iridium;2-methyl-6-pyridin-2-yl-7H-[1]benzofuro[2,3-b]pyridin-7-ide;2-phenylpyridine (PubChem CID 153485048) has the molecular formula C28H19IrN3O-2
and a molecular weight of 605.70 g/mol. Its IUPAC name is iridium;2-methyl-6-pyridin-2-yl-7H-[1]benzofuro[2,3-b]pyridin-7-ide;2-phenylpyridine.
Molecular Properties
| Compound Name | iridium;2-methyl-6-pyridin-2-yl-7H-[1]benzofuro[2,3-b]pyridin-7-ide;2-phenylpyridine |
| PubChem CID | 153485048 |
| Molecular Formula | C28H19IrN3O-2 |
| Molecular Weight | 605.70 g/mol |
| Exact Mass | 606.12 |
| IUPAC Name | iridium;2-methyl-6-pyridin-2-yl-7H-[1]benzofuro[2,3-b]pyridin-7-ide;2-phenylpyridine |
| SMILES | Cc1ccc2c(n1)oc1c[c-]c(-c3ccccn3)cc12.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C17H11N2O.C11H8N.Ir/c1-11-5-7-13-14-10-12(15-4-2-3-9-18-15)6-8-16(14)20-17(13)19-11;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h2-5,7-10H,1H3;1-6,8-9H;/q2*-1; |
| InChIKey | ODAAYGGSPUIAAS-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 605.70 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze iridium;2-methyl-6-pyridin-2-yl-7H-[1]benzofuro[2,3-b]pyridin-7-ide;2-phenylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iridium;2-methyl-6-pyridin-2-yl-7H-[1]benzofuro[2,3-b]pyridin-7-ide;2-phenylpyridine?
The IUPAC name of iridium;2-methyl-6-pyridin-2-yl-7H-[1]benzofuro[2,3-b]pyridin-7-ide;2-phenylpyridine (CID 153485048) is iridium;2-methyl-6-pyridin-2-yl-7H-[1]benzofuro[2,3-b]pyridin-7-ide;2-phenylpyridine.
What is the SMILES notation for iridium;2-methyl-6-pyridin-2-yl-7H-[1]benzofuro[2,3-b]pyridin-7-ide;2-phenylpyridine?
The canonical SMILES for iridium;2-methyl-6-pyridin-2-yl-7H-[1]benzofuro[2,3-b]pyridin-7-ide;2-phenylpyridine is Cc1ccc2c(n1)oc1c[c-]c(-c3ccccn3)cc12.[Ir].[c-]1ccccc1-c1ccccn1.
What is the InChIKey of iridium;2-methyl-6-pyridin-2-yl-7H-[1]benzofuro[2,3-b]pyridin-7-ide;2-phenylpyridine?
The InChIKey is ODAAYGGSPUIAAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11N2O.C11H8N.Ir/c1-11-5-7-13-14-10-12(15-4-2-3-9-18-15)6-8-16(14)20-17(13)19-11;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h2-5,7-10H,1H3;1-6,8-9H;/q2*-1;.
What are the key properties of iridium;2-methyl-6-pyridin-2-yl-7H-[1]benzofuro[2,3-b]pyridin-7-ide;2-phenylpyridine?
iridium;2-methyl-6-pyridin-2-yl-7H-[1]benzofuro[2,3-b]pyridin-7-ide;2-phenylpyridine has a molecular weight of 605.70 g/mol, XLogP of 6.70, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for iridium;2-methyl-6-pyridin-2-yl-7H-[1]benzofuro[2,3-b]pyridin-7-ide;2-phenylpyridine is sourced from PubChem (CID 153485048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).