C24H34N6O13 — CID 153485197
methyl 3-[3-[3-[2-[3-(2-acetyloxyethyl)-5-(2-hydroxyethyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]ethoxy]-3-oxopropyl]-2,4,6-trioxo-5-propyl-1,3,5-triazinan-1-yl]propanoate (PubChem CID 153485197) has the molecular formula C24H34N6O13 and a molecular weight of 614.57 g/mol. Its IUPAC name is methyl 3-[3-[3-[2-[3-(2-acetyloxyethyl)-5-(2-hydroxyethyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]ethoxy]-3-oxopropyl]-2,4,6-trioxo-5-propyl-1,3,5-triazinan-1-yl]propanoate.
| Compound Name | methyl 3-[3-[3-[2-[3-(2-acetyloxyethyl)-5-(2-hydroxyethyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]ethoxy]-3-oxopropyl]-2,4,6-trioxo-5-propyl-1,3,5-triazinan-1-yl]propanoate |
|---|---|
| PubChem CID | 153485197 |
| Molecular Formula | C24H34N6O13 |
| Molecular Weight | 614.57 g/mol |
| Exact Mass | 614.22 |
| IUPAC Name | methyl 3-[3-[3-[2-[3-(2-acetyloxyethyl)-5-(2-hydroxyethyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]ethoxy]-3-oxopropyl]-2,4,6-trioxo-5-propyl-1,3,5-triazinan-1-yl]propanoate |
| SMILES | CCCn1c(=O)n(CCC(=O)OC)c(=O)n(CCC(=O)OCCn2c(=O)n(CCO)c(=O)n(CCOC(C)=O)c2=O)c1=O |
| InChI | InChI=1S/C24H34N6O13/c1-4-7-25-19(35)26(8-5-17(33)41-3)21(37)27(20(25)36)9-6-18(34)43-15-12-30-23(39)28(10-13-31)22(38)29(24(30)40)11-14-42-16(2)32/h31H,4-15H2,1-3H3 |
| InChIKey | IZJOTGIGUPPPJE-UHFFFAOYSA-N |
| XLogP | -4.18 |
| TPSA | 231.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.57 |
| LogP ≤ 5 | -4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|